C36H31N2O2Pt- — CID 164742819
2-[4-(3-tert-butyl-5-pyridin-2-ylbenzene-6-id-1-yl)-1,3-benzoxazol-2-yl]-3-(1-phenylethyl)phenol;platinum (PubChem CID 164742819) has the molecular formula C36H31N2O2Pt- and a molecular weight of 718.73 g/mol. Its IUPAC name is 2-[4-(3-tert-butyl-5-pyridin-2-ylbenzene-6-id-1-yl)-1,3-benzoxazol-2-yl]-3-(1-phenylethyl)phenol;platinum.
| Compound Name | 2-[4-(3-tert-butyl-5-pyridin-2-ylbenzene-6-id-1-yl)-1,3-benzoxazol-2-yl]-3-(1-phenylethyl)phenol;platinum |
|---|---|
| PubChem CID | 164742819 |
| Molecular Formula | C36H31N2O2Pt- |
| Molecular Weight | 718.73 g/mol |
| Exact Mass | 718.20 |
| IUPAC Name | 2-[4-(3-tert-butyl-5-pyridin-2-ylbenzene-6-id-1-yl)-1,3-benzoxazol-2-yl]-3-(1-phenylethyl)phenol;platinum |
| SMILES | CC(c1ccccc1)c1cccc(O)c1-c1nc2c(-c3[c-]c(-c4ccccn4)cc(C(C)(C)C)c3)cccc2o1.[Pt] |
| InChI | InChI=1S/C36H31N2O2.Pt/c1-23(24-12-6-5-7-13-24)28-14-10-17-31(39)33(28)35-38-34-29(15-11-18-32(34)40-35)25-20-26(30-16-8-9-19-37-30)22-27(21-25)36(2,3)4;/h5-19,21-23,39H,1-4H3;/q-1; |
| InChIKey | COSZASTZEZWJRL-UHFFFAOYSA-N |
| XLogP | 9.18 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.73 |
| LogP ≤ 5 | 9.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|