C37H28N3O2Pt- — CID 177110792
2-[4-[3-(6-tert-butylquinolin-8-yl)-5-pyridin-2-ylbenzene-2-id-1-yl]-1,3-benzoxazol-2-yl]phenol;platinum (PubChem CID 177110792) has the molecular formula C37H28N3O2Pt- and a molecular weight of 741.73 g/mol. Its IUPAC name is 2-[4-[3-(6-tert-butylquinolin-8-yl)-5-pyridin-2-ylbenzene-2-id-1-yl]-1,3-benzoxazol-2-yl]phenol;platinum.
| Compound Name | 2-[4-[3-(6-tert-butylquinolin-8-yl)-5-pyridin-2-ylbenzene-2-id-1-yl]-1,3-benzoxazol-2-yl]phenol;platinum |
|---|---|
| PubChem CID | 177110792 |
| Molecular Formula | C37H28N3O2Pt- |
| Molecular Weight | 741.73 g/mol |
| Exact Mass | 741.18 |
| IUPAC Name | 2-[4-[3-(6-tert-butylquinolin-8-yl)-5-pyridin-2-ylbenzene-2-id-1-yl]-1,3-benzoxazol-2-yl]phenol;platinum |
| SMILES | CC(C)(C)c1cc(-c2[c-]c(-c3cccc4oc(-c5ccccc5O)nc34)cc(-c3ccccn3)c2)c2ncccc2c1.[Pt] |
| InChI | InChI=1S/C37H28N3O2.Pt/c1-37(2,3)27-21-23-10-9-17-39-34(23)30(22-27)25-18-24(19-26(20-25)31-13-6-7-16-38-31)28-12-8-15-33-35(28)40-36(42-33)29-11-4-5-14-32(29)41;/h4-17,19-22,41H,1-3H3;/q-1; |
| InChIKey | BWXOZPKJQLQWOT-UHFFFAOYSA-N |
| XLogP | 9.24 |
| TPSA | 72.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.73 |
| LogP ≤ 5 | 9.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|