C49H43N2O2Pt- — CID 177110695
2-[4-[3-[6-[2,6-di(propan-2-yl)phenyl]quinolin-8-yl]-5-(2,4,6-trimethylphenyl)benzene-2-id-1-yl]-1,3-benzoxazol-2-yl]phenol;platinum (PubChem CID 177110695) has the molecular formula C49H43N2O2Pt- and a molecular weight of 886.97 g/mol. Its IUPAC name is 2-[4-[3-[6-[2,6-di(propan-2-yl)phenyl]quinolin-8-yl]-5-(2,4,6-trimethylphenyl)benzene-2-id-1-yl]-1,3-benzoxazol-2-yl]phenol;platinum.
| Compound Name | 2-[4-[3-[6-[2,6-di(propan-2-yl)phenyl]quinolin-8-yl]-5-(2,4,6-trimethylphenyl)benzene-2-id-1-yl]-1,3-benzoxazol-2-yl]phenol;platinum |
|---|---|
| PubChem CID | 177110695 |
| Molecular Formula | C49H43N2O2Pt- |
| Molecular Weight | 886.97 g/mol |
| Exact Mass | 886.30 |
| IUPAC Name | 2-[4-[3-[6-[2,6-di(propan-2-yl)phenyl]quinolin-8-yl]-5-(2,4,6-trimethylphenyl)benzene-2-id-1-yl]-1,3-benzoxazol-2-yl]phenol;platinum |
| SMILES | Cc1cc(C)c(-c2cc(-c3cc(-c4c(C(C)C)cccc4C(C)C)cc4cccnc34)[c-]c(-c3cccc4oc(-c5ccccc5O)nc34)c2)c(C)c1.[Pt] |
| InChI | InChI=1S/C49H43N2O2.Pt/c1-28(2)38-15-10-16-39(29(3)4)46(38)37-23-33-13-12-20-50-47(33)42(27-37)35-24-34(25-36(26-35)45-31(6)21-30(5)22-32(45)7)40-17-11-19-44-48(40)51-49(53-44)41-14-8-9-18-43(41)52;/h8-23,25-29,52H,1-7H3;/q-1; |
| InChIKey | HYAALVVVHXUWQH-UHFFFAOYSA-N |
| XLogP | 13.39 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 886.97 |
| LogP ≤ 5 | 13.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|