C34H19N2O3Pt- — CID 177110784
2-[4-[3-([1]benzofuro[3,2-f]quinolin-5-yl)benzene-2-id-1-yl]-1,3-benzoxazol-2-yl]phenol;platinum (PubChem CID 177110784) has the molecular formula C34H19N2O3Pt- and a molecular weight of 698.62 g/mol. Its IUPAC name is 2-[4-[3-([1]benzofuro[3,2-f]quinolin-5-yl)benzene-2-id-1-yl]-1,3-benzoxazol-2-yl]phenol;platinum.
| Compound Name | 2-[4-[3-([1]benzofuro[3,2-f]quinolin-5-yl)benzene-2-id-1-yl]-1,3-benzoxazol-2-yl]phenol;platinum |
|---|---|
| PubChem CID | 177110784 |
| Molecular Formula | C34H19N2O3Pt- |
| Molecular Weight | 698.62 g/mol |
| Exact Mass | 698.10 |
| IUPAC Name | 2-[4-[3-([1]benzofuro[3,2-f]quinolin-5-yl)benzene-2-id-1-yl]-1,3-benzoxazol-2-yl]phenol;platinum |
| SMILES | Oc1ccccc1-c1nc2c(-c3[c-]c(-c4cc5oc6ccccc6c5c5cccnc45)ccc3)cccc2o1.[Pt] |
| InChI | InChI=1S/C34H19N2O3.Pt/c37-27-14-3-1-10-23(27)34-36-33-22(12-6-16-29(33)39-34)20-8-5-9-21(18-20)26-19-30-31(25-13-7-17-35-32(25)26)24-11-2-4-15-28(24)38-30;/h1-17,19,37H;/q-1; |
| InChIKey | FYFWTDJCAQFTJM-UHFFFAOYSA-N |
| XLogP | 8.78 |
| TPSA | 72.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.62 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|