C44H33N2O2Pt- — CID 177110090
2-[4-[3-(6-tert-butylquinolin-8-yl)-5-phenylbenzene-2-id-1-yl]-6-phenyl-1,3-benzoxazol-2-yl]phenol;platinum (PubChem CID 177110090) has the molecular formula C44H33N2O2Pt- and a molecular weight of 816.84 g/mol. Its IUPAC name is 2-[4-[3-(6-tert-butylquinolin-8-yl)-5-phenylbenzene-2-id-1-yl]-6-phenyl-1,3-benzoxazol-2-yl]phenol;platinum.
| Compound Name | 2-[4-[3-(6-tert-butylquinolin-8-yl)-5-phenylbenzene-2-id-1-yl]-6-phenyl-1,3-benzoxazol-2-yl]phenol;platinum |
|---|---|
| PubChem CID | 177110090 |
| Molecular Formula | C44H33N2O2Pt- |
| Molecular Weight | 816.84 g/mol |
| Exact Mass | 816.22 |
| IUPAC Name | 2-[4-[3-(6-tert-butylquinolin-8-yl)-5-phenylbenzene-2-id-1-yl]-6-phenyl-1,3-benzoxazol-2-yl]phenol;platinum |
| SMILES | CC(C)(C)c1cc(-c2[c-]c(-c3cc(-c4ccccc4)cc4oc(-c5ccccc5O)nc34)cc(-c3ccccc3)c2)c2ncccc2c1.[Pt] |
| InChI | InChI=1S/C44H33N2O2.Pt/c1-44(2,3)35-24-30-17-12-20-45-41(30)38(27-35)34-22-31(28-13-6-4-7-14-28)21-33(23-34)37-25-32(29-15-8-5-9-16-29)26-40-42(37)46-43(48-40)36-18-10-11-19-39(36)47;/h4-22,24-27,47H,1-3H3;/q-1; |
| InChIKey | TVYUUONQTOXYJV-UHFFFAOYSA-N |
| XLogP | 11.51 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 816.84 |
| LogP ≤ 5 | 11.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|