C62H62N3OPt- — CID 177110486
2-[1,6-bis(4-tert-butylphenyl)-4-[3-(6-tert-butylquinolin-8-yl)-5-phenylbenzene-2-id-1-yl]benzimidazol-2-yl]-4-tert-butylphenol;platinum (PubChem CID 177110486) has the molecular formula C62H62N3OPt- and a molecular weight of 1060.28 g/mol. Its IUPAC name is 2-[1,6-bis(4-tert-butylphenyl)-4-[3-(6-tert-butylquinolin-8-yl)-5-phenylbenzene-2-id-1-yl]benzimidazol-2-yl]-4-tert-butylphenol;platinum.
| Compound Name | 2-[1,6-bis(4-tert-butylphenyl)-4-[3-(6-tert-butylquinolin-8-yl)-5-phenylbenzene-2-id-1-yl]benzimidazol-2-yl]-4-tert-butylphenol;platinum |
|---|---|
| PubChem CID | 177110486 |
| Molecular Formula | C62H62N3OPt- |
| Molecular Weight | 1060.28 g/mol |
| Exact Mass | 1059.45 |
| IUPAC Name | 2-[1,6-bis(4-tert-butylphenyl)-4-[3-(6-tert-butylquinolin-8-yl)-5-phenylbenzene-2-id-1-yl]benzimidazol-2-yl]-4-tert-butylphenol;platinum |
| SMILES | CC(C)(C)c1ccc(-c2cc(-c3[c-]c(-c4cc(C(C)(C)C)cc5cccnc45)cc(-c4ccccc4)c3)c3nc(-c4cc(C(C)(C)C)ccc4O)n(-c4ccc(C(C)(C)C)cc4)c3c2)cc1.[Pt] |
| InChI | InChI=1S/C62H62N3O.Pt/c1-59(2,3)46-22-20-40(21-23-46)43-35-51(44-31-42(39-17-14-13-15-18-39)32-45(33-44)52-38-49(62(10,11)12)34-41-19-16-30-63-56(41)52)57-54(36-43)65(50-27-24-47(25-28-50)60(4,5)6)58(64-57)53-37-48(61(7,8)9)26-29-55(53)66;/h13-32,34-38,66H,1-12H3;/q-1; |
| InChIKey | QXDZAWPEDPWPQC-UHFFFAOYSA-N |
| XLogP | 16.60 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1060.28 |
| LogP ≤ 5 | 16.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|