C49H42F2N3OPt- — CID 177110819
2-[4-[3-tert-butyl-5-[6-[difluoro(phenyl)methyl]quinolin-8-yl]benzene-6-id-1-yl]-1-(4-tert-butylphenyl)benzimidazol-2-yl]phenol;platinum (PubChem CID 177110819) has the molecular formula C49H42F2N3OPt- and a molecular weight of 921.97 g/mol. Its IUPAC name is 2-[4-[3-tert-butyl-5-[6-[difluoro(phenyl)methyl]quinolin-8-yl]benzene-6-id-1-yl]-1-(4-tert-butylphenyl)benzimidazol-2-yl]phenol;platinum.
| Compound Name | 2-[4-[3-tert-butyl-5-[6-[difluoro(phenyl)methyl]quinolin-8-yl]benzene-6-id-1-yl]-1-(4-tert-butylphenyl)benzimidazol-2-yl]phenol;platinum |
|---|---|
| PubChem CID | 177110819 |
| Molecular Formula | C49H42F2N3OPt- |
| Molecular Weight | 921.97 g/mol |
| Exact Mass | 921.29 |
| IUPAC Name | 2-[4-[3-tert-butyl-5-[6-[difluoro(phenyl)methyl]quinolin-8-yl]benzene-6-id-1-yl]-1-(4-tert-butylphenyl)benzimidazol-2-yl]phenol;platinum |
| SMILES | CC(C)(C)c1ccc(-n2c(-c3ccccc3O)nc3c(-c4[c-]c(-c5cc(C(F)(F)c6ccccc6)cc6cccnc56)cc(C(C)(C)C)c4)cccc32)cc1.[Pt] |
| InChI | InChI=1S/C49H42F2N3O.Pt/c1-47(2,3)34-21-23-38(24-22-34)54-42-19-12-18-39(45(42)53-46(54)40-17-10-11-20-43(40)55)32-26-33(29-36(28-32)48(4,5)6)41-30-37(27-31-14-13-25-52-44(31)41)49(50,51)35-15-8-7-9-16-35;/h7-25,27-30,55H,1-6H3;/q-1; |
| InChIKey | PPTGHMUDCDLOSY-UHFFFAOYSA-N |
| XLogP | 12.81 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 921.97 |
| LogP ≤ 5 | 12.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|