C43H40N3OPt- — CID 177109975
4-tert-butyl-2-[4-[3-(6-tert-butyl-4-methylquinolin-8-yl)benzene-2-id-1-yl]-1-phenylbenzimidazol-2-yl]phenol;platinum (PubChem CID 177109975) has the molecular formula C43H40N3OPt- and a molecular weight of 809.89 g/mol. Its IUPAC name is 4-tert-butyl-2-[4-[3-(6-tert-butyl-4-methylquinolin-8-yl)benzene-2-id-1-yl]-1-phenylbenzimidazol-2-yl]phenol;platinum.
| Compound Name | 4-tert-butyl-2-[4-[3-(6-tert-butyl-4-methylquinolin-8-yl)benzene-2-id-1-yl]-1-phenylbenzimidazol-2-yl]phenol;platinum |
|---|---|
| PubChem CID | 177109975 |
| Molecular Formula | C43H40N3OPt- |
| Molecular Weight | 809.89 g/mol |
| Exact Mass | 809.28 |
| IUPAC Name | 4-tert-butyl-2-[4-[3-(6-tert-butyl-4-methylquinolin-8-yl)benzene-2-id-1-yl]-1-phenylbenzimidazol-2-yl]phenol;platinum |
| SMILES | Cc1ccnc2c(-c3[c-]c(-c4cccc5c4nc(-c4cc(C(C)(C)C)ccc4O)n5-c4ccccc4)ccc3)cc(C(C)(C)C)cc12.[Pt] |
| InChI | InChI=1S/C43H40N3O.Pt/c1-27-21-22-44-39-34(27)25-31(43(5,6)7)26-35(39)29-14-11-13-28(23-29)33-17-12-18-37-40(33)45-41(46(37)32-15-9-8-10-16-32)36-24-30(42(2,3)4)19-20-38(36)47;/h8-22,24-26,47H,1-7H3;/q-1; |
| InChIKey | CJRFCOIVDCOGHO-UHFFFAOYSA-N |
| XLogP | 10.98 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 809.89 |
| LogP ≤ 5 | 10.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|