C46H46N3OPt- — CID 177110645
2-[4-[3-tert-butyl-5-(6-tert-butylquinolin-8-yl)benzene-6-id-1-yl]-1-(4-tert-butylphenyl)benzimidazol-2-yl]phenol;platinum (PubChem CID 177110645) has the molecular formula C46H46N3OPt- and a molecular weight of 851.97 g/mol. Its IUPAC name is 2-[4-[3-tert-butyl-5-(6-tert-butylquinolin-8-yl)benzene-6-id-1-yl]-1-(4-tert-butylphenyl)benzimidazol-2-yl]phenol;platinum.
| Compound Name | 2-[4-[3-tert-butyl-5-(6-tert-butylquinolin-8-yl)benzene-6-id-1-yl]-1-(4-tert-butylphenyl)benzimidazol-2-yl]phenol;platinum |
|---|---|
| PubChem CID | 177110645 |
| Molecular Formula | C46H46N3OPt- |
| Molecular Weight | 851.97 g/mol |
| Exact Mass | 851.33 |
| IUPAC Name | 2-[4-[3-tert-butyl-5-(6-tert-butylquinolin-8-yl)benzene-6-id-1-yl]-1-(4-tert-butylphenyl)benzimidazol-2-yl]phenol;platinum |
| SMILES | CC(C)(C)c1ccc(-n2c(-c3ccccc3O)nc3c(-c4[c-]c(-c5cc(C(C)(C)C)cc6cccnc56)cc(C(C)(C)C)c4)cccc32)cc1.[Pt] |
| InChI | InChI=1S/C46H46N3O.Pt/c1-44(2,3)32-19-21-35(22-20-32)49-39-17-12-16-36(42(39)48-43(49)37-15-10-11-18-40(37)50)30-24-31(27-33(26-30)45(4,5)6)38-28-34(46(7,8)9)25-29-14-13-23-47-41(29)38;/h10-23,25-28,50H,1-9H3;/q-1; |
| InChIKey | XVNMPQASCPKIBK-UHFFFAOYSA-N |
| XLogP | 11.97 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 851.97 |
| LogP ≤ 5 | 11.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|