C50H46N3OPt- — CID 177110974
2-[1-(4-tert-butylphenyl)-4-[3-(6-tert-butylquinolin-8-yl)benzene-2-id-1-yl]benzimidazol-2-yl]-4-(2,6-dimethylphenyl)phenol;platinum (PubChem CID 177110974) has the molecular formula C50H46N3OPt- and a molecular weight of 900.02 g/mol. Its IUPAC name is 2-[1-(4-tert-butylphenyl)-4-[3-(6-tert-butylquinolin-8-yl)benzene-2-id-1-yl]benzimidazol-2-yl]-4-(2,6-dimethylphenyl)phenol;platinum.
| Compound Name | 2-[1-(4-tert-butylphenyl)-4-[3-(6-tert-butylquinolin-8-yl)benzene-2-id-1-yl]benzimidazol-2-yl]-4-(2,6-dimethylphenyl)phenol;platinum |
|---|---|
| PubChem CID | 177110974 |
| Molecular Formula | C50H46N3OPt- |
| Molecular Weight | 900.02 g/mol |
| Exact Mass | 899.33 |
| IUPAC Name | 2-[1-(4-tert-butylphenyl)-4-[3-(6-tert-butylquinolin-8-yl)benzene-2-id-1-yl]benzimidazol-2-yl]-4-(2,6-dimethylphenyl)phenol;platinum |
| SMILES | Cc1cccc(C)c1-c1ccc(O)c(-c2nc3c(-c4[c-]c(-c5cc(C(C)(C)C)cc6cccnc56)ccc4)cccc3n2-c2ccc(C(C)(C)C)cc2)c1.[Pt] |
| InChI | InChI=1S/C50H46N3O.Pt/c1-31-13-9-14-32(2)45(31)35-20-25-44(54)42(29-35)48-52-47-40(18-11-19-43(47)53(48)39-23-21-37(22-24-39)49(3,4)5)33-15-10-16-34(27-33)41-30-38(50(6,7)8)28-36-17-12-26-51-46(36)41;/h9-26,28-30,54H,1-8H3;/q-1; |
| InChIKey | ONTPXTXQQZTVIS-UHFFFAOYSA-N |
| XLogP | 12.96 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 900.02 |
| LogP ≤ 5 | 12.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|