C39H32N2O2 — CID 177110020
2-[6-benzyl-4-[3-(6-tert-butylquinolin-8-yl)phenyl]-1,3-benzoxazol-2-yl]phenol (PubChem CID 177110020) has the molecular formula C39H32N2O2 and a molecular weight of 560.70 g/mol. Its IUPAC name is 2-[6-benzyl-4-[3-(6-tert-butylquinolin-8-yl)phenyl]-1,3-benzoxazol-2-yl]phenol.
| Compound Name | 2-[6-benzyl-4-[3-(6-tert-butylquinolin-8-yl)phenyl]-1,3-benzoxazol-2-yl]phenol |
|---|---|
| PubChem CID | 177110020 |
| Molecular Formula | C39H32N2O2 |
| Molecular Weight | 560.70 g/mol |
| Exact Mass | 560.25 |
| IUPAC Name | 2-[6-benzyl-4-[3-(6-tert-butylquinolin-8-yl)phenyl]-1,3-benzoxazol-2-yl]phenol |
| SMILES | CC(C)(C)c1cc(-c2cccc(-c3cc(Cc4ccccc4)cc4oc(-c5ccccc5O)nc34)c2)c2ncccc2c1 |
| InChI | InChI=1S/C39H32N2O2/c1-39(2,3)30-23-29-15-10-18-40-36(29)33(24-30)28-14-9-13-27(22-28)32-20-26(19-25-11-5-4-6-12-25)21-35-37(32)41-38(43-35)31-16-7-8-17-34(31)42/h4-18,20-24,42H,19H2,1-3H3 |
| InChIKey | WIQKAOQCVUGCCZ-UHFFFAOYSA-N |
| XLogP | 9.97 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.70 |
| LogP ≤ 5 | 9.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |