C22H18F3O3S+ — CID 164746362
(4-methoxycarbonylphenyl)-phenyl-[4-(2,2,2-trifluoroethoxy)phenyl]sulfanium (PubChem CID 164746362) has the molecular formula C22H18F3O3S+ and a molecular weight of 419.44 g/mol. Its IUPAC name is (4-methoxycarbonylphenyl)-phenyl-[4-(2,2,2-trifluoroethoxy)phenyl]sulfanium.
| Compound Name | (4-methoxycarbonylphenyl)-phenyl-[4-(2,2,2-trifluoroethoxy)phenyl]sulfanium |
|---|---|
| PubChem CID | 164746362 |
| Molecular Formula | C22H18F3O3S+ |
| Molecular Weight | 419.44 g/mol |
| Exact Mass | 419.09 |
| IUPAC Name | (4-methoxycarbonylphenyl)-phenyl-[4-(2,2,2-trifluoroethoxy)phenyl]sulfanium |
| SMILES | COC(=O)c1ccc([S+](c2ccccc2)c2ccc(OCC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C22H18F3O3S/c1-27-21(26)16-7-11-19(12-8-16)29(18-5-3-2-4-6-18)20-13-9-17(10-14-20)28-15-22(23,24)25/h2-14H,15H2,1H3/q+1 |
| InChIKey | NNRUABSADYIJTQ-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.44 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|