C24H20F5O4S+ — CID 164746661
[2-methoxy-3-(2,2,3,3,3-pentafluoropropoxycarbonyl)phenyl]-(2-methoxyphenyl)-phenylsulfanium (PubChem CID 164746661) has the molecular formula C24H20F5O4S+ and a molecular weight of 499.48 g/mol. Its IUPAC name is [2-methoxy-3-(2,2,3,3,3-pentafluoropropoxycarbonyl)phenyl]-(2-methoxyphenyl)-phenylsulfanium.
| Compound Name | [2-methoxy-3-(2,2,3,3,3-pentafluoropropoxycarbonyl)phenyl]-(2-methoxyphenyl)-phenylsulfanium |
|---|---|
| PubChem CID | 164746661 |
| Molecular Formula | C24H20F5O4S+ |
| Molecular Weight | 499.48 g/mol |
| Exact Mass | 499.10 |
| IUPAC Name | [2-methoxy-3-(2,2,3,3,3-pentafluoropropoxycarbonyl)phenyl]-(2-methoxyphenyl)-phenylsulfanium |
| SMILES | COc1ccccc1[S+](c1ccccc1)c1cccc(C(=O)OCC(F)(F)C(F)(F)F)c1OC |
| InChI | InChI=1S/C24H20F5O4S/c1-31-18-12-6-7-13-19(18)34(16-9-4-3-5-10-16)20-14-8-11-17(21(20)32-2)22(30)33-15-23(25,26)24(27,28)29/h3-14H,15H2,1-2H3/q+1 |
| InChIKey | NOZXLLKQAQTTBH-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.48 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|