C11H19F2O3- — CID 164747328
2,2-difluoro-2-nonoxyacetate (PubChem CID 164747328) has the molecular formula C11H19F2O3- and a molecular weight of 237.27 g/mol. Its IUPAC name is 2,2-difluoro-2-nonoxyacetate.
| Compound Name | 2,2-difluoro-2-nonoxyacetate |
|---|---|
| PubChem CID | 164747328 |
| Molecular Formula | C11H19F2O3- |
| Molecular Weight | 237.27 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | 2,2-difluoro-2-nonoxyacetate |
| SMILES | CCCCCCCCCOC(F)(F)C(=O)[O-] |
| InChI | InChI=1S/C11H20F2O3/c1-2-3-4-5-6-7-8-9-16-11(12,13)10(14)15/h2-9H2,1H3,(H,14,15)/p-1 |
| InChIKey | NYFOFFIGHAWPNS-UHFFFAOYSA-M |
| XLogP | 2.10 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.27 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|