C22H13F6O3S+ — CID 164747552
1,1,1,3,3,3-hexafluoropropan-2-yl 3-phenoxathiin-10-ium-10-ylbenzoate (PubChem CID 164747552) has the molecular formula C22H13F6O3S+ and a molecular weight of 471.40 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 3-phenoxathiin-10-ium-10-ylbenzoate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 3-phenoxathiin-10-ium-10-ylbenzoate |
|---|---|
| PubChem CID | 164747552 |
| Molecular Formula | C22H13F6O3S+ |
| Molecular Weight | 471.40 g/mol |
| Exact Mass | 471.05 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 3-phenoxathiin-10-ium-10-ylbenzoate |
| SMILES | O=C(OC(C(F)(F)F)C(F)(F)F)c1cccc([S+]2c3ccccc3Oc3ccccc32)c1 |
| InChI | InChI=1S/C22H13F6O3S/c23-21(24,25)20(22(26,27)28)31-19(29)13-6-5-7-14(12-13)32-17-10-3-1-8-15(17)30-16-9-2-4-11-18(16)32/h1-12,20H/q+1 |
| InChIKey | RYRUGNTXTFMPMB-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.40 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|