About CID 164749115
CID 164749115 (PubChem CID 164749115) has the molecular formula C37H47IrN2O2Si-
and a molecular weight of 772.10 g/mol.
Molecular Properties
| Compound Name | CID 164749115 |
| PubChem CID | 164749115 |
| Molecular Formula | C37H47IrN2O2Si- |
| Molecular Weight | 772.10 g/mol |
| Exact Mass | 772.30 |
| IUPAC Name | — |
| SMILES | CC1(C)c2cc3c([Si](C)(C)C)cccc3nc2-c2[c-]ccc3cncc1c23.CCC(CC)C(=O)/C=C(\O)C(CC)CC.[Ir] |
| InChI | InChI=1S/C24H23N2Si.C13H24O2.Ir/c1-24(2)18-12-17-20(10-7-11-21(17)27(3,4)5)26-23(18)16-9-6-8-15-13-25-14-19(24)22(15)16;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;/h6-8,10-14H,1-5H3;9-11,14H,5-8H2,1-4H3;/q-1;;/b;12-9-; |
| InChIKey | GGCAAMTVTMQLAD-DZTQYQPZSA-N |
| XLogP | 9.30 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 772.10 |
| LogP ≤ 5 | 9.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze CID 164749115 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 164749115?
The IUPAC name of CID 164749115 (CID 164749115) is not available.
What is the SMILES notation for CID 164749115?
The canonical SMILES for CID 164749115 is CC1(C)c2cc3c([Si](C)(C)C)cccc3nc2-c2[c-]ccc3cncc1c23.CCC(CC)C(=O)/C=C(\O)C(CC)CC.[Ir].
What is the InChIKey of CID 164749115?
The InChIKey is GGCAAMTVTMQLAD-DZTQYQPZSA-N. The full InChI is InChI=1S/C24H23N2Si.C13H24O2.Ir/c1-24(2)18-12-17-20(10-7-11-21(17)27(3,4)5)26-23(18)16-9-6-8-15-13-25-14-19(24)22(15)16;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;/h6-8,10-14H,1-5H3;9-11,14H,5-8H2,1-4H3;/q-1;;/b;12-9-;.
What are the key properties of CID 164749115?
CID 164749115 has a molecular weight of 772.10 g/mol, XLogP of 9.30, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 164749115 is sourced from PubChem (CID 164749115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).