About CID 164748292
CID 164748292 (PubChem CID 164748292) has the molecular formula C41H47IrN2O2Si-
and a molecular weight of 820.14 g/mol.
Molecular Properties
| Compound Name | CID 164748292 |
| PubChem CID | 164748292 |
| Molecular Formula | C41H47IrN2O2Si- |
| Molecular Weight | 820.14 g/mol |
| Exact Mass | 820.30 |
| IUPAC Name | — |
| SMILES | CCC(CC)C(=O)/C=C(\O)C(CC)CC.C[Si](C)(C)c1cccc2nc3c(cc12)N(c1ccccc1)c1cccc2cc[c-]c-3c12.[Ir] |
| InChI | InChI=1S/C28H23N2Si.C13H24O2.Ir/c1-31(2,3)26-17-9-15-23-22(26)18-25-28(29-23)21-14-7-10-19-11-8-16-24(27(19)21)30(25)20-12-5-4-6-13-20;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;/h4-13,15-18H,1-3H3;9-11,14H,5-8H2,1-4H3;/q-1;;/b;12-9-; |
| InChIKey | OHGKIBCQUPKECF-DZTQYQPZSA-N |
| XLogP | 11.05 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 820.14 |
| LogP ≤ 5 | 11.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze CID 164748292 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 164748292?
The IUPAC name of CID 164748292 (CID 164748292) is not available.
What is the SMILES notation for CID 164748292?
The canonical SMILES for CID 164748292 is CCC(CC)C(=O)/C=C(\O)C(CC)CC.C[Si](C)(C)c1cccc2nc3c(cc12)N(c1ccccc1)c1cccc2cc[c-]c-3c12.[Ir].
What is the InChIKey of CID 164748292?
The InChIKey is OHGKIBCQUPKECF-DZTQYQPZSA-N. The full InChI is InChI=1S/C28H23N2Si.C13H24O2.Ir/c1-31(2,3)26-17-9-15-23-22(26)18-25-28(29-23)21-14-7-10-19-11-8-16-24(27(19)21)30(25)20-12-5-4-6-13-20;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;/h4-13,15-18H,1-3H3;9-11,14H,5-8H2,1-4H3;/q-1;;/b;12-9-;.
What are the key properties of CID 164748292?
CID 164748292 has a molecular weight of 820.14 g/mol, XLogP of 11.05, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 164748292 is sourced from PubChem (CID 164748292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).