C20H19ClF2N4O3 — CID 164751156
5-[[2-[(2R,5S)-2-(3-chloro-4,5-difluorophenyl)-5-methylpiperidin-1-yl]-2-oxoacetyl]amino]pyridine-3-carboxamide (PubChem CID 164751156) has the molecular formula C20H19ClF2N4O3 and a molecular weight of 436.85 g/mol. Its IUPAC name is 5-[[2-[(2R,5S)-2-(3-chloro-4,5-difluorophenyl)-5-methylpiperidin-1-yl]-2-oxoacetyl]amino]pyridine-3-carboxamide.
| Compound Name | 5-[[2-[(2R,5S)-2-(3-chloro-4,5-difluorophenyl)-5-methylpiperidin-1-yl]-2-oxoacetyl]amino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 164751156 |
| Molecular Formula | C20H19ClF2N4O3 |
| Molecular Weight | 436.85 g/mol |
| Exact Mass | 436.11 |
| IUPAC Name | 5-[[2-[(2R,5S)-2-(3-chloro-4,5-difluorophenyl)-5-methylpiperidin-1-yl]-2-oxoacetyl]amino]pyridine-3-carboxamide |
| SMILES | C[C@H]1CC[C@H](c2cc(F)c(F)c(Cl)c2)N(C(=O)C(=O)Nc2cncc(C(N)=O)c2)C1 |
| InChI | InChI=1S/C20H19ClF2N4O3/c1-10-2-3-16(11-5-14(21)17(23)15(22)6-11)27(9-10)20(30)19(29)26-13-4-12(18(24)28)7-25-8-13/h4-8,10,16H,2-3,9H2,1H3,(H2,24,28)(H,26,29)/t10-,16+/m0/s1 |
| InChIKey | RTOXZECZBYXKNB-MGPLVRAMSA-N |
| XLogP | 3.05 |
| TPSA | 105.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.85 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|