C22H24N6O4 — CID 164751460
5-[[2-[2-(3H-benzimidazol-5-yl)-5-methylpiperidin-1-yl]-2-oxoacetyl]amino]-2-methoxypyridine-3-carboxamide (PubChem CID 164751460) has the molecular formula C22H24N6O4 and a molecular weight of 436.47 g/mol. Its IUPAC name is 5-[[2-[2-(3H-benzimidazol-5-yl)-5-methylpiperidin-1-yl]-2-oxoacetyl]amino]-2-methoxypyridine-3-carboxamide.
| Compound Name | 5-[[2-[2-(3H-benzimidazol-5-yl)-5-methylpiperidin-1-yl]-2-oxoacetyl]amino]-2-methoxypyridine-3-carboxamide |
|---|---|
| PubChem CID | 164751460 |
| Molecular Formula | C22H24N6O4 |
| Molecular Weight | 436.47 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | 5-[[2-[2-(3H-benzimidazol-5-yl)-5-methylpiperidin-1-yl]-2-oxoacetyl]amino]-2-methoxypyridine-3-carboxamide |
| SMILES | COc1ncc(NC(=O)C(=O)N2CC(C)CCC2c2ccc3nc[nH]c3c2)cc1C(N)=O |
| InChI | InChI=1S/C22H24N6O4/c1-12-3-6-18(13-4-5-16-17(7-13)26-11-25-16)28(10-12)22(31)20(30)27-14-8-15(19(23)29)21(32-2)24-9-14/h4-5,7-9,11-12,18H,3,6,10H2,1-2H3,(H2,23,29)(H,25,26)(H,27,30) |
| InChIKey | VDLHCSBIKXRDEF-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 143.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.47 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|