C23H26N6O4 — CID 166022662
2-methoxy-5-[[2-[(2S,5R)-5-methyl-2-(2-methylindazol-5-yl)piperidin-1-yl]-2-oxoacetyl]amino]pyridine-3-carboxamide (PubChem CID 166022662) has the molecular formula C23H26N6O4 and a molecular weight of 450.50 g/mol. Its IUPAC name is 2-methoxy-5-[[2-[(2S,5R)-5-methyl-2-(2-methylindazol-5-yl)piperidin-1-yl]-2-oxoacetyl]amino]pyridine-3-carboxamide.
| Compound Name | 2-methoxy-5-[[2-[(2S,5R)-5-methyl-2-(2-methylindazol-5-yl)piperidin-1-yl]-2-oxoacetyl]amino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 166022662 |
| Molecular Formula | C23H26N6O4 |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 450.20 |
| IUPAC Name | 2-methoxy-5-[[2-[(2S,5R)-5-methyl-2-(2-methylindazol-5-yl)piperidin-1-yl]-2-oxoacetyl]amino]pyridine-3-carboxamide |
| SMILES | COc1ncc(NC(=O)C(=O)N2C[C@H](C)CC[C@H]2c2ccc3nn(C)cc3c2)cc1C(N)=O |
| InChI | InChI=1S/C23H26N6O4/c1-13-4-7-19(14-5-6-18-15(8-14)12-28(2)27-18)29(11-13)23(32)21(31)26-16-9-17(20(24)30)22(33-3)25-10-16/h5-6,8-10,12-13,19H,4,7,11H2,1-3H3,(H2,24,30)(H,26,31)/t13-,19+/m1/s1 |
| InChIKey | VYCVPXVBDAQMQV-YJYMSZOUSA-N |
| XLogP | 2.01 |
| TPSA | 132.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.50 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|