C15H18FLiNO3- — CID 164751513
lithium;1-[2-(4-fluoro-3-methylphenyl)-5-methylpiperidin-1-yl]ethane-1,2-dione;hydroxide (PubChem CID 164751513) has the molecular formula C15H18FLiNO3- and a molecular weight of 286.25 g/mol. Its IUPAC name is lithium;1-[2-(4-fluoro-3-methylphenyl)-5-methylpiperidin-1-yl]ethane-1,2-dione;hydroxide.
| Compound Name | lithium;1-[2-(4-fluoro-3-methylphenyl)-5-methylpiperidin-1-yl]ethane-1,2-dione;hydroxide |
|---|---|
| PubChem CID | 164751513 |
| Molecular Formula | C15H18FLiNO3- |
| Molecular Weight | 286.25 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | lithium;1-[2-(4-fluoro-3-methylphenyl)-5-methylpiperidin-1-yl]ethane-1,2-dione;hydroxide |
| SMILES | Cc1cc(C2CCC(C)CN2C(=O)[C-]=O)ccc1F.[Li+].[OH-] |
| InChI | InChI=1S/C15H17FNO2.Li.H2O/c1-10-3-6-14(17(8-10)15(19)9-18)12-4-5-13(16)11(2)7-12;;/h4-5,7,10,14H,3,6,8H2,1-2H3;;1H2/q-1;+1;/p-1 |
| InChIKey | OBJCHZSXYJAELO-UHFFFAOYSA-M |
| XLogP | -0.63 |
| TPSA | 67.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.25 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|