C22H33N5O3 — CID 164752095
2-[(2R,5S)-2-(4-acetamidocyclohexyl)-5-methylpiperidin-1-yl]-N-(6-amino-5-methyl-3-pyridinyl)-2-oxoacetamide (PubChem CID 164752095) has the molecular formula C22H33N5O3 and a molecular weight of 415.54 g/mol. Its IUPAC name is 2-[(2R,5S)-2-(4-acetamidocyclohexyl)-5-methylpiperidin-1-yl]-N-(6-amino-5-methyl-3-pyridinyl)-2-oxoacetamide.
| Compound Name | 2-[(2R,5S)-2-(4-acetamidocyclohexyl)-5-methylpiperidin-1-yl]-N-(6-amino-5-methyl-3-pyridinyl)-2-oxoacetamide |
|---|---|
| PubChem CID | 164752095 |
| Molecular Formula | C22H33N5O3 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.26 |
| IUPAC Name | 2-[(2R,5S)-2-(4-acetamidocyclohexyl)-5-methylpiperidin-1-yl]-N-(6-amino-5-methyl-3-pyridinyl)-2-oxoacetamide |
| SMILES | CC(=O)NC1CCC([C@H]2CC[C@H](C)CN2C(=O)C(=O)Nc2cnc(N)c(C)c2)CC1 |
| InChI | InChI=1S/C22H33N5O3/c1-13-4-9-19(16-5-7-17(8-6-16)25-15(3)28)27(12-13)22(30)21(29)26-18-10-14(2)20(23)24-11-18/h10-11,13,16-17,19H,4-9,12H2,1-3H3,(H2,23,24)(H,25,28)(H,26,29)/t13-,16?,17?,19+/m0/s1 |
| InChIKey | FVYGSUDKDSYQJK-NNOIFHNPSA-N |
| XLogP | 2.23 |
| TPSA | 117.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|