C20H20ClFN4O3 — CID 164752668
5-[[2-[(2S,5R)-2-(3-chloro-5-fluorophenyl)-5-methylpiperidin-1-yl]-2-oxoacetyl]amino]pyridine-3-carboxamide (PubChem CID 164752668) has the molecular formula C20H20ClFN4O3 and a molecular weight of 418.86 g/mol. Its IUPAC name is 5-[[2-[(2S,5R)-2-(3-chloro-5-fluorophenyl)-5-methylpiperidin-1-yl]-2-oxoacetyl]amino]pyridine-3-carboxamide.
| Compound Name | 5-[[2-[(2S,5R)-2-(3-chloro-5-fluorophenyl)-5-methylpiperidin-1-yl]-2-oxoacetyl]amino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 164752668 |
| Molecular Formula | C20H20ClFN4O3 |
| Molecular Weight | 418.86 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | 5-[[2-[(2S,5R)-2-(3-chloro-5-fluorophenyl)-5-methylpiperidin-1-yl]-2-oxoacetyl]amino]pyridine-3-carboxamide |
| SMILES | C[C@@H]1CC[C@@H](c2cc(F)cc(Cl)c2)N(C(=O)C(=O)Nc2cncc(C(N)=O)c2)C1 |
| InChI | InChI=1S/C20H20ClFN4O3/c1-11-2-3-17(12-4-14(21)7-15(22)5-12)26(10-11)20(29)19(28)25-16-6-13(18(23)27)8-24-9-16/h4-9,11,17H,2-3,10H2,1H3,(H2,23,27)(H,25,28)/t11-,17+/m1/s1 |
| InChIKey | CXHCMOQGRNTFDV-DIFFPNOSSA-N |
| XLogP | 2.91 |
| TPSA | 105.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.86 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|