C27H43N3O2 — CID 164753842
tert-butyl (2R,5S)-5-methyl-2-[4-(9-methyl-2,9-diazaspiro[5.5]undecan-2-yl)phenyl]piperidine-1-carboxylate (PubChem CID 164753842) has the molecular formula C27H43N3O2 and a molecular weight of 441.66 g/mol. Its IUPAC name is tert-butyl (2R,5S)-5-methyl-2-[4-(9-methyl-2,9-diazaspiro[5.5]undecan-2-yl)phenyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (2R,5S)-5-methyl-2-[4-(9-methyl-2,9-diazaspiro[5.5]undecan-2-yl)phenyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 164753842 |
| Molecular Formula | C27H43N3O2 |
| Molecular Weight | 441.66 g/mol |
| Exact Mass | 441.34 |
| IUPAC Name | tert-butyl (2R,5S)-5-methyl-2-[4-(9-methyl-2,9-diazaspiro[5.5]undecan-2-yl)phenyl]piperidine-1-carboxylate |
| SMILES | C[C@H]1CC[C@H](c2ccc(N3CCCC4(CCN(C)CC4)C3)cc2)N(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C27H43N3O2/c1-21-7-12-24(30(19-21)25(31)32-26(2,3)4)22-8-10-23(11-9-22)29-16-6-13-27(20-29)14-17-28(5)18-15-27/h8-11,21,24H,6-7,12-20H2,1-5H3/t21-,24+/m0/s1 |
| InChIKey | SOMFZNKQQPSQQZ-XUZZJYLKSA-N |
| XLogP | 5.71 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.66 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|