C9H18NO2 — CID 164753988
CID 164753988 (PubChem CID 164753988) has the molecular formula C9H18NO2 and a molecular weight of 172.25 g/mol.
| Compound Name | CID 164753988 |
|---|---|
| PubChem CID | 164753988 |
| Molecular Formula | C9H18NO2 |
| Molecular Weight | 172.25 g/mol |
| Exact Mass | 172.13 |
| IUPAC Name | — |
| SMILES | [CH2]C(C)OC(=O)[C@@H](N)CC(C)C |
| InChI | InChI=1S/C9H18NO2/c1-6(2)5-8(10)9(11)12-7(3)4/h6-8H,3,5,10H2,1-2,4H3/t7?,8-/m0/s1 |
| InChIKey | VRSAAAKIZZNMMD-MQWKRIRWSA-N |
| XLogP | 1.13 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.25 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |