C35H26NOSSi+ — CID 164756855
1-methyl-2-(3-methyldibenzofuran-4-yl)-4,4-diphenyl-[1]benzosilolo[3,2-d][1,3]thiazol-1-ium (PubChem CID 164756855) has the molecular formula C35H26NOSSi+ and a molecular weight of 536.75 g/mol. Its IUPAC name is 1-methyl-2-(3-methyldibenzofuran-4-yl)-4,4-diphenyl-[1]benzosilolo[3,2-d][1,3]thiazol-1-ium.
| Compound Name | 1-methyl-2-(3-methyldibenzofuran-4-yl)-4,4-diphenyl-[1]benzosilolo[3,2-d][1,3]thiazol-1-ium |
|---|---|
| PubChem CID | 164756855 |
| Molecular Formula | C35H26NOSSi+ |
| Molecular Weight | 536.75 g/mol |
| Exact Mass | 536.15 |
| IUPAC Name | 1-methyl-2-(3-methyldibenzofuran-4-yl)-4,4-diphenyl-[1]benzosilolo[3,2-d][1,3]thiazol-1-ium |
| SMILES | Cc1ccc2c(oc3ccccc32)c1-c1sc2c([n+]1C)-c1ccccc1[Si]2(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C35H26NOSSi/c1-23-21-22-27-26-17-9-11-19-29(26)37-33(27)31(23)34-36(2)32-28-18-10-12-20-30(28)39(35(32)38-34,24-13-5-3-6-14-24)25-15-7-4-8-16-25/h3-22H,1-2H3/q+1 |
| InChIKey | XCXJGECVCSBCNY-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.75 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|