C32H34IrNO2S2- — CID 164756941
2-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-[1]benzothiolo[2,3-d][1,3]thiazole;(Z)-5-hydroxy-2,6-dimethylhept-4-en-3-one;iridium (PubChem CID 164756941) has the molecular formula C32H34IrNO2S2- and a molecular weight of 720.98 g/mol. Its IUPAC name is 2-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-[1]benzothiolo[2,3-d][1,3]thiazole;(Z)-5-hydroxy-2,6-dimethylhept-4-en-3-one;iridium.
| Compound Name | 2-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-[1]benzothiolo[2,3-d][1,3]thiazole;(Z)-5-hydroxy-2,6-dimethylhept-4-en-3-one;iridium |
|---|---|
| PubChem CID | 164756941 |
| Molecular Formula | C32H34IrNO2S2- |
| Molecular Weight | 720.98 g/mol |
| Exact Mass | 721.17 |
| IUPAC Name | 2-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-[1]benzothiolo[2,3-d][1,3]thiazole;(Z)-5-hydroxy-2,6-dimethylhept-4-en-3-one;iridium |
| SMILES | CC(C)(C)c1cc(-c2nc3sc4ccccc4c3s2)[c-]c2ccccc12.CC(C)C(=O)/C=C(\O)C(C)C.[Ir] |
| InChI | InChI=1S/C23H18NS2.C9H16O2.Ir/c1-23(2,3)18-13-15(12-14-8-4-5-9-16(14)18)21-24-22-20(26-21)17-10-6-7-11-19(17)25-22;1-6(2)8(10)5-9(11)7(3)4;/h4-11,13H,1-3H3;5-7,10H,1-4H3;/q-1;;/b;8-5-; |
| InChIKey | ZIGULQBPSQPLGP-QBBOVCHSSA-N |
| XLogP | 9.74 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.98 |
| LogP ≤ 5 | 9.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|