C57H36N6 — CID 164757226
10-(4,6-diphenylpyrimidin-2-yl)-21-(4,6-diphenyl-1,3,5-triazin-2-yl)-17-phenyl-14-azapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(21),2,4,6,8(13),9,11,15(20),16,18-decaene (PubChem CID 164757226) has the molecular formula C57H36N6 and a molecular weight of 804.96 g/mol. Its IUPAC name is 10-(4,6-diphenylpyrimidin-2-yl)-21-(4,6-diphenyl-1,3,5-triazin-2-yl)-17-phenyl-14-azapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(21),2,4,6,8(13),9,11,15(20),16,18-decaene.
| Compound Name | 10-(4,6-diphenylpyrimidin-2-yl)-21-(4,6-diphenyl-1,3,5-triazin-2-yl)-17-phenyl-14-azapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(21),2,4,6,8(13),9,11,15(20),16,18-decaene |
|---|---|
| PubChem CID | 164757226 |
| Molecular Formula | C57H36N6 |
| Molecular Weight | 804.96 g/mol |
| Exact Mass | 804.30 |
| IUPAC Name | 10-(4,6-diphenylpyrimidin-2-yl)-21-(4,6-diphenyl-1,3,5-triazin-2-yl)-17-phenyl-14-azapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(21),2,4,6,8(13),9,11,15(20),16,18-decaene |
| SMILES | c1ccc(-c2ccc3c(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)c4c5ccccc5c5cc(-c6nc(-c7ccccc7)cc(-c7ccccc7)n6)ccc5n4c3c2)cc1 |
| InChI | InChI=1S/C57H36N6/c1-6-18-37(19-7-1)42-30-32-46-51(35-42)63-50-33-31-43(56-58-48(38-20-8-2-9-21-38)36-49(59-56)39-22-10-3-11-23-39)34-47(50)44-28-16-17-29-45(44)53(63)52(46)57-61-54(40-24-12-4-13-25-40)60-55(62-57)41-26-14-5-15-27-41/h1-36H |
| InChIKey | LJYMFJZAMSOCBW-UHFFFAOYSA-N |
| XLogP | 14.04 |
| TPSA | 68.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 804.96 |
| LogP ≤ 5 | 14.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|