C26H35N5O3 — CID 164757503
6-[[benzyl-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]amino]methyl]-4-N-(4-methylphenyl)pyrimidine-2,4-diamine (PubChem CID 164757503) has the molecular formula C26H35N5O3 and a molecular weight of 465.60 g/mol. Its IUPAC name is 6-[[benzyl-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]amino]methyl]-4-N-(4-methylphenyl)pyrimidine-2,4-diamine.
| Compound Name | 6-[[benzyl-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]amino]methyl]-4-N-(4-methylphenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 164757503 |
| Molecular Formula | C26H35N5O3 |
| Molecular Weight | 465.60 g/mol |
| Exact Mass | 465.27 |
| IUPAC Name | 6-[[benzyl-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]amino]methyl]-4-N-(4-methylphenyl)pyrimidine-2,4-diamine |
| SMILES | COCCOCCOCCN(Cc1ccccc1)Cc1cc(Nc2ccc(C)cc2)nc(N)n1 |
| InChI | InChI=1S/C26H35N5O3/c1-21-8-10-23(11-9-21)28-25-18-24(29-26(27)30-25)20-31(19-22-6-4-3-5-7-22)12-13-33-16-17-34-15-14-32-2/h3-11,18H,12-17,19-20H2,1-2H3,(H3,27,28,29,30) |
| InChIKey | YRZWVJLAIQIPDH-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 94.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.60 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|