About CID 164759162
CID 164759162 (PubChem CID 164759162) has the molecular formula C44H32N2O6S2
and a molecular weight of 748.88 g/mol.
Molecular Properties
| Compound Name | CID 164759162 |
| PubChem CID | 164759162 |
| Molecular Formula | C44H32N2O6S2 |
| Molecular Weight | 748.88 g/mol |
| Exact Mass | 748.17 |
| IUPAC Name | — |
| SMILES | O=c1c(=Nc2cc3c(s2)-c2cc4c(cc2C2(CCCCC2)O3)-c2sc(N=c3c(=O)c5ccccc5c3=O)cc2OC42CCCCC2)c(=O)c2ccccc12 |
| InChI | InChI=1S/C44H32N2O6S2/c47-37-23-11-3-4-12-24(23)38(48)35(37)45-33-21-31-41(53-33)27-20-30-28(19-29(27)43(51-31)15-7-1-8-16-43)42-32(52-44(30)17-9-2-10-18-44)22-34(54-42)46-36-39(49)25-13-5-6-14-26(25)40(36)50/h3-6,11-14,19-22H,1-2,7-10,15-18H2 |
| InChIKey | AEZHLIVJMOBWQR-UHFFFAOYSA-N |
| XLogP | 8.21 |
| TPSA | 111.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 54 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 748.88 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Analyze CID 164759162 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 164759162?
The IUPAC name of CID 164759162 (CID 164759162) is not available.
What is the SMILES notation for CID 164759162?
The canonical SMILES for CID 164759162 is O=c1c(=Nc2cc3c(s2)-c2cc4c(cc2C2(CCCCC2)O3)-c2sc(N=c3c(=O)c5ccccc5c3=O)cc2OC42CCCCC2)c(=O)c2ccccc12.
What is the InChIKey of CID 164759162?
The InChIKey is AEZHLIVJMOBWQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C44H32N2O6S2/c47-37-23-11-3-4-12-24(23)38(48)35(37)45-33-21-31-41(53-33)27-20-30-28(19-29(27)43(51-31)15-7-1-8-16-43)42-32(52-44(30)17-9-2-10-18-44)22-34(54-42)46-36-39(49)25-13-5-6-14-26(25)40(36)50/h3-6,11-14,19-22H,1-2,7-10,15-18H2.
What are the key properties of CID 164759162?
CID 164759162 has a molecular weight of 748.88 g/mol, XLogP of 8.21, 2 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for CID 164759162 is sourced from PubChem (CID 164759162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).