C47H26N4O4 — CID 164765324
3-carbazol-9-yl-11-(4,6-diphenyl-1,3,5-triazin-2-yl)chromeno[2,3-b]xanthene-7,14-dione (PubChem CID 164765324) has the molecular formula C47H26N4O4 and a molecular weight of 710.75 g/mol. Its IUPAC name is 3-carbazol-9-yl-11-(4,6-diphenyl-1,3,5-triazin-2-yl)chromeno[2,3-b]xanthene-7,14-dione.
| Compound Name | 3-carbazol-9-yl-11-(4,6-diphenyl-1,3,5-triazin-2-yl)chromeno[2,3-b]xanthene-7,14-dione |
|---|---|
| PubChem CID | 164765324 |
| Molecular Formula | C47H26N4O4 |
| Molecular Weight | 710.75 g/mol |
| Exact Mass | 710.20 |
| IUPAC Name | 3-carbazol-9-yl-11-(4,6-diphenyl-1,3,5-triazin-2-yl)chromeno[2,3-b]xanthene-7,14-dione |
| SMILES | O=c1c2ccc(-n3c4ccccc4c4ccccc43)cc2oc2cc3c(=O)c4cccc(-c5nc(-c6ccccc6)nc(-c6ccccc6)n5)c4oc3cc12 |
| InChI | InChI=1S/C47H26N4O4/c52-42-32-23-22-29(51-37-20-9-7-16-30(37)31-17-8-10-21-38(31)51)24-39(32)54-40-25-36-41(26-35(40)42)55-44-33(43(36)53)18-11-19-34(44)47-49-45(27-12-3-1-4-13-27)48-46(50-47)28-14-5-2-6-15-28/h1-26H |
| InChIKey | YXYOCGCHGGGCQH-UHFFFAOYSA-N |
| XLogP | 10.49 |
| TPSA | 104.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.75 |
| LogP ≤ 5 | 10.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|