About CID 174101121
CID 174101121 (PubChem CID 174101121) has the molecular formula C45H23B5N4O
and a molecular weight of 689.77 g/mol.
Molecular Properties
| Compound Name | CID 174101121 |
| PubChem CID | 174101121 |
| Molecular Formula | C45H23B5N4O |
| Molecular Weight | 689.77 g/mol |
| Exact Mass | 690.23 |
| IUPAC Name | — |
| SMILES | [B]c1c([B])c([B])c(-c2ccc(-c3nc(-c4ccccc4)nc(-c4cccc5c4oc4cc(-n6c7ccccc7c7ccccc76)ccc45)n3)cc2)c([B])c1[B] |
| InChI | InChI=1S/C45H23B5N4O/c46-37-36(38(47)40(49)41(50)39(37)48)24-17-19-26(20-18-24)44-51-43(25-9-2-1-3-10-25)52-45(53-44)32-14-8-13-31-30-22-21-27(23-35(30)55-42(31)32)54-33-15-6-4-11-28(33)29-12-5-7-16-34(29)54/h1-23H |
| InChIKey | QAKHSHKDGKMFQN-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 55 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 689.77 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 174101121 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 174101121?
The IUPAC name of CID 174101121 (CID 174101121) is not available.
What is the SMILES notation for CID 174101121?
The canonical SMILES for CID 174101121 is [B]c1c([B])c([B])c(-c2ccc(-c3nc(-c4ccccc4)nc(-c4cccc5c4oc4cc(-n6c7ccccc7c7ccccc76)ccc45)n3)cc2)c([B])c1[B].
What is the InChIKey of CID 174101121?
The InChIKey is QAKHSHKDGKMFQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C45H23B5N4O/c46-37-36(38(47)40(49)41(50)39(37)48)24-17-19-26(20-18-24)44-51-43(25-9-2-1-3-10-25)52-45(53-44)32-14-8-13-31-30-22-21-27(23-35(30)55-42(31)32)54-33-15-6-4-11-28(33)29-12-5-7-16-34(29)54/h1-23H.
What are the key properties of CID 174101121?
CID 174101121 has a molecular weight of 689.77 g/mol, XLogP of 5.51, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 174101121 is sourced from PubChem (CID 174101121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).