C51H27B5N4O — CID 174071924
CID 174071924 (PubChem CID 174071924) has the molecular formula C51H27B5N4O and a molecular weight of 765.86 g/mol.
| Compound Name | CID 174071924 |
|---|---|
| PubChem CID | 174071924 |
| Molecular Formula | C51H27B5N4O |
| Molecular Weight | 765.86 g/mol |
| Exact Mass | 766.27 |
| IUPAC Name | — |
| SMILES | [B]c1c([B])c([B])c(-c2ccc(-c3nc(-c4ccccc4)nc(-c4ccc5c(c4)oc4c(-c6ccc7c(c6)c6ccccc6n7-c6ccccc6)cccc45)n3)cc2)c([B])c1[B] |
| InChI | InChI=1S/C51H27B5N4O/c52-43-42(44(53)46(55)47(56)45(43)54)28-18-20-30(21-19-28)50-57-49(29-10-3-1-4-11-29)58-51(59-50)32-22-24-36-37-16-9-15-34(48(37)61-41(36)27-32)31-23-25-40-38(26-31)35-14-7-8-17-39(35)60(40)33-12-5-2-6-13-33/h1-27H |
| InChIKey | PPBUHNTZGPLQIW-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.86 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|