C27H32FN7O — CID 164767239
N-[(2-ethyl-3-methylimidazol-4-yl)methyl]-2-[6-fluoro-5-[2-(methylamino)ethylamino]-2-pyridinyl]-N,6-dimethylquinoline-4-carboxamide (PubChem CID 164767239) has the molecular formula C27H32FN7O and a molecular weight of 489.60 g/mol. Its IUPAC name is N-[(2-ethyl-3-methylimidazol-4-yl)methyl]-2-[6-fluoro-5-[2-(methylamino)ethylamino]-2-pyridinyl]-N,6-dimethylquinoline-4-carboxamide.
| Compound Name | N-[(2-ethyl-3-methylimidazol-4-yl)methyl]-2-[6-fluoro-5-[2-(methylamino)ethylamino]-2-pyridinyl]-N,6-dimethylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 164767239 |
| Molecular Formula | C27H32FN7O |
| Molecular Weight | 489.60 g/mol |
| Exact Mass | 489.27 |
| IUPAC Name | N-[(2-ethyl-3-methylimidazol-4-yl)methyl]-2-[6-fluoro-5-[2-(methylamino)ethylamino]-2-pyridinyl]-N,6-dimethylquinoline-4-carboxamide |
| SMILES | CCc1ncc(CN(C)C(=O)c2cc(-c3ccc(NCCNC)c(F)n3)nc3ccc(C)cc23)n1C |
| InChI | InChI=1S/C27H32FN7O/c1-6-25-31-15-18(35(25)5)16-34(4)27(36)20-14-24(32-21-8-7-17(2)13-19(20)21)22-9-10-23(26(28)33-22)30-12-11-29-3/h7-10,13-15,29-30H,6,11-12,16H2,1-5H3 |
| InChIKey | SARNLYKFNMVFMS-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 87.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.60 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|