C30H41N7O2 — CID 167060321
N-[(E)-3-[ethyl-(methylideneamino)amino]-2-methylbut-2-enyl]-6-(methoxymethyl)-N-methyl-2-[6-methyl-5-[2-(methylamino)ethylamino]-2-pyridinyl]quinoline-4-carboxamide (PubChem CID 167060321) has the molecular formula C30H41N7O2 and a molecular weight of 531.71 g/mol. Its IUPAC name is N-[(E)-3-[ethyl-(methylideneamino)amino]-2-methylbut-2-enyl]-6-(methoxymethyl)-N-methyl-2-[6-methyl-5-[2-(methylamino)ethylamino]-2-pyridinyl]quinoline-4-carboxamide.
| Compound Name | N-[(E)-3-[ethyl-(methylideneamino)amino]-2-methylbut-2-enyl]-6-(methoxymethyl)-N-methyl-2-[6-methyl-5-[2-(methylamino)ethylamino]-2-pyridinyl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 167060321 |
| Molecular Formula | C30H41N7O2 |
| Molecular Weight | 531.71 g/mol |
| Exact Mass | 531.33 |
| IUPAC Name | N-[(E)-3-[ethyl-(methylideneamino)amino]-2-methylbut-2-enyl]-6-(methoxymethyl)-N-methyl-2-[6-methyl-5-[2-(methylamino)ethylamino]-2-pyridinyl]quinoline-4-carboxamide |
| SMILES | C=NN(CC)/C(C)=C(\C)CN(C)C(=O)c1cc(-c2ccc(NCCNC)c(C)n2)nc2ccc(COC)cc12 |
| InChI | InChI=1S/C30H41N7O2/c1-9-37(32-6)22(4)20(2)18-36(7)30(38)25-17-29(35-27-11-10-23(19-39-8)16-24(25)27)28-13-12-26(21(3)34-28)33-15-14-31-5/h10-13,16-17,31,33H,6,9,14-15,18-19H2,1-5,7-8H3/b22-20+ |
| InChIKey | YTOHDLAQXYFLHV-LSDHQDQOSA-N |
| XLogP | 4.69 |
| TPSA | 94.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.71 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|