C54H34N6 — CID 164767771
11-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2,3,7-triphenylpyrazino[2,3-k]phenanthridine (PubChem CID 164767771) has the molecular formula C54H34N6 and a molecular weight of 766.91 g/mol. Its IUPAC name is 11-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2,3,7-triphenylpyrazino[2,3-k]phenanthridine.
| Compound Name | 11-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2,3,7-triphenylpyrazino[2,3-k]phenanthridine |
|---|---|
| PubChem CID | 164767771 |
| Molecular Formula | C54H34N6 |
| Molecular Weight | 766.91 g/mol |
| Exact Mass | 766.28 |
| IUPAC Name | 11-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2,3,7-triphenylpyrazino[2,3-k]phenanthridine |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3ccc(-c4ccc5nc(-c6ccccc6)c6ccc7nc(-c8ccccc8)c(-c8ccccc8)nc7c6c5c4)cc3)n2)cc1 |
| InChI | InChI=1S/C54H34N6/c1-6-16-36(17-7-1)48-43-31-33-46-51(57-50(38-20-10-3-11-21-38)49(56-46)37-18-8-2-9-19-37)47(43)44-34-42(30-32-45(44)55-48)35-26-28-41(29-27-35)54-59-52(39-22-12-4-13-23-39)58-53(60-54)40-24-14-5-15-25-40/h1-34H |
| InChIKey | MTRNZZNNGSPTCW-UHFFFAOYSA-N |
| XLogP | 13.19 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.91 |
| LogP ≤ 5 | 13.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|