C27H19N3O3 — CID 164768534
2-(4-ethoxy-6-naphtho[2,1-b][1]benzofuran-9-yl-1,3,5-triazin-2-yl)phenol (PubChem CID 164768534) has the molecular formula C27H19N3O3 and a molecular weight of 433.47 g/mol. Its IUPAC name is 2-(4-ethoxy-6-naphtho[2,1-b][1]benzofuran-9-yl-1,3,5-triazin-2-yl)phenol.
| Compound Name | 2-(4-ethoxy-6-naphtho[2,1-b][1]benzofuran-9-yl-1,3,5-triazin-2-yl)phenol |
|---|---|
| PubChem CID | 164768534 |
| Molecular Formula | C27H19N3O3 |
| Molecular Weight | 433.47 g/mol |
| Exact Mass | 433.14 |
| IUPAC Name | 2-(4-ethoxy-6-naphtho[2,1-b][1]benzofuran-9-yl-1,3,5-triazin-2-yl)phenol |
| SMILES | CCOc1nc(-c2ccc3c(c2)oc2ccc4ccccc4c23)nc(-c2ccccc2O)n1 |
| InChI | InChI=1S/C27H19N3O3/c1-2-32-27-29-25(28-26(30-27)19-9-5-6-10-21(19)31)17-11-13-20-23(15-17)33-22-14-12-16-7-3-4-8-18(16)24(20)22/h3-15,31H,2H2,1H3 |
| InChIKey | GAOLSDTYYQNGKW-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 81.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.47 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |