C25H14ClN3O — CID 147220347
2-chloro-4-naphtho[2,1-b][1]benzofuran-9-yl-6-phenyl-1,3,5-triazine (PubChem CID 147220347) has the molecular formula C25H14ClN3O and a molecular weight of 407.86 g/mol. Its IUPAC name is 2-chloro-4-naphtho[2,1-b][1]benzofuran-9-yl-6-phenyl-1,3,5-triazine.
| Compound Name | 2-chloro-4-naphtho[2,1-b][1]benzofuran-9-yl-6-phenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 147220347 |
| Molecular Formula | C25H14ClN3O |
| Molecular Weight | 407.86 g/mol |
| Exact Mass | 407.08 |
| IUPAC Name | 2-chloro-4-naphtho[2,1-b][1]benzofuran-9-yl-6-phenyl-1,3,5-triazine |
| SMILES | Clc1nc(-c2ccccc2)nc(-c2ccc3c(c2)oc2ccc4ccccc4c23)n1 |
| InChI | InChI=1S/C25H14ClN3O/c26-25-28-23(16-7-2-1-3-8-16)27-24(29-25)17-10-12-19-21(14-17)30-20-13-11-15-6-4-5-9-18(15)22(19)20/h1-14H |
| InChIKey | CGYCKGLMEHJZGC-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.86 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |