C33H46N8O6 — CID 164771429
3-[2-[4-(4-amino-2-butyl-3H-imidazo[4,5-c]quinolin-8-yl)piperazin-1-yl]ethoxy]-N-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethyl]propanamide (PubChem CID 164771429) has the molecular formula C33H46N8O6 and a molecular weight of 650.78 g/mol. Its IUPAC name is 3-[2-[4-(4-amino-2-butyl-3H-imidazo[4,5-c]quinolin-8-yl)piperazin-1-yl]ethoxy]-N-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethyl]propanamide.
| Compound Name | 3-[2-[4-(4-amino-2-butyl-3H-imidazo[4,5-c]quinolin-8-yl)piperazin-1-yl]ethoxy]-N-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethyl]propanamide |
|---|---|
| PubChem CID | 164771429 |
| Molecular Formula | C33H46N8O6 |
| Molecular Weight | 650.78 g/mol |
| Exact Mass | 650.35 |
| IUPAC Name | 3-[2-[4-(4-amino-2-butyl-3H-imidazo[4,5-c]quinolin-8-yl)piperazin-1-yl]ethoxy]-N-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethyl]propanamide |
| SMILES | CCCCc1nc2c([nH]1)c(N)nc1ccc(N3CCN(CCOCCC(=O)NCCOCCOCCN4C(=O)C=CC4=O)CC3)cc12 |
| InChI | InChI=1S/C33H46N8O6/c1-2-3-4-27-37-31-25-23-24(5-6-26(25)36-33(34)32(31)38-27)40-13-11-39(12-14-40)15-19-45-17-9-28(42)35-10-18-46-21-22-47-20-16-41-29(43)7-8-30(41)44/h5-8,23H,2-4,9-22H2,1H3,(H2,34,36)(H,35,42)(H,37,38) |
| InChIKey | RLGPYAUOFYIIRH-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 168.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.78 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|