C35H53N8O6+ — CID 165063199
3-[2-[4-(4-amino-2-butyl-3H-imidazo[4,5-c]quinolin-8-yl)-1-methylpiperazin-1-ium-1-yl]ethoxy]-N-[2-[2-[2-(3-methyl-2,5-dioxopyrrolidin-1-yl)ethoxy]ethoxy]ethyl]propanamide (PubChem CID 165063199) has the molecular formula C35H53N8O6+ and a molecular weight of 681.86 g/mol. Its IUPAC name is 3-[2-[4-(4-amino-2-butyl-3H-imidazo[4,5-c]quinolin-8-yl)-1-methylpiperazin-1-ium-1-yl]ethoxy]-N-[2-[2-[2-(3-methyl-2,5-dioxopyrrolidin-1-yl)ethoxy]ethoxy]ethyl]propanamide.
| Compound Name | 3-[2-[4-(4-amino-2-butyl-3H-imidazo[4,5-c]quinolin-8-yl)-1-methylpiperazin-1-ium-1-yl]ethoxy]-N-[2-[2-[2-(3-methyl-2,5-dioxopyrrolidin-1-yl)ethoxy]ethoxy]ethyl]propanamide |
|---|---|
| PubChem CID | 165063199 |
| Molecular Formula | C35H53N8O6+ |
| Molecular Weight | 681.86 g/mol |
| Exact Mass | 681.41 |
| IUPAC Name | 3-[2-[4-(4-amino-2-butyl-3H-imidazo[4,5-c]quinolin-8-yl)-1-methylpiperazin-1-ium-1-yl]ethoxy]-N-[2-[2-[2-(3-methyl-2,5-dioxopyrrolidin-1-yl)ethoxy]ethoxy]ethyl]propanamide |
| SMILES | CCCCc1nc2c([nH]1)c(N)nc1ccc(N3CC[N+](C)(CCOCCC(=O)NCCOCCOCCN4C(=O)CC(C)C4=O)CC3)cc12 |
| InChI | InChI=1S/C35H52N8O6/c1-4-5-6-29-39-32-27-24-26(7-8-28(27)38-34(36)33(32)40-29)41-11-14-43(3,15-12-41)16-20-47-17-9-30(44)37-10-18-48-21-22-49-19-13-42-31(45)23-25(2)35(42)46/h7-8,24-25H,4-6,9-23H2,1-3H3,(H3-,36,37,38,39,40,44)/p+1 |
| InChIKey | JHGGGIFRTFLDPT-UHFFFAOYSA-O |
| XLogP | 2.25 |
| TPSA | 165.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.86 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|