C17H34S2 — CID 164776938
(Z)-1-(4,4-dimethylpentyldisulfanyl)dec-3-ene (PubChem CID 164776938) has the molecular formula C17H34S2 and a molecular weight of 302.59 g/mol. Its IUPAC name is (Z)-1-(4,4-dimethylpentyldisulfanyl)dec-3-ene.
| Compound Name | (Z)-1-(4,4-dimethylpentyldisulfanyl)dec-3-ene |
|---|---|
| PubChem CID | 164776938 |
| Molecular Formula | C17H34S2 |
| Molecular Weight | 302.59 g/mol |
| Exact Mass | 302.21 |
| IUPAC Name | (Z)-1-(4,4-dimethylpentyldisulfanyl)dec-3-ene |
| SMILES | CCCCCC/C=C\CCSSCCCC(C)(C)C |
| InChI | InChI=1S/C17H34S2/c1-5-6-7-8-9-10-11-12-15-18-19-16-13-14-17(2,3)4/h10-11H,5-9,12-16H2,1-4H3/b11-10- |
| InChIKey | CHHPDEVCYUYVSW-KHPPLWFESA-N |
| XLogP | 7.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.59 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|