C50H36N2SSi — CID 164778524
[3-(5H-benzimidazolo[1,2-a][3,1]benzothiazin-2-yl)phenyl]-phenyl-bis(3-phenylphenyl)silane (PubChem CID 164778524) has the molecular formula C50H36N2SSi and a molecular weight of 725.01 g/mol. Its IUPAC name is [3-(5H-benzimidazolo[1,2-a][3,1]benzothiazin-2-yl)phenyl]-phenyl-bis(3-phenylphenyl)silane.
| Compound Name | [3-(5H-benzimidazolo[1,2-a][3,1]benzothiazin-2-yl)phenyl]-phenyl-bis(3-phenylphenyl)silane |
|---|---|
| PubChem CID | 164778524 |
| Molecular Formula | C50H36N2SSi |
| Molecular Weight | 725.01 g/mol |
| Exact Mass | 724.24 |
| IUPAC Name | [3-(5H-benzimidazolo[1,2-a][3,1]benzothiazin-2-yl)phenyl]-phenyl-bis(3-phenylphenyl)silane |
| SMILES | c1ccc(-c2cccc([Si](c3ccccc3)(c3cccc(-c4ccccc4)c3)c3cccc(-c4ccc5c(c4)-n4c(nc6ccccc64)SC5)c3)c2)cc1 |
| InChI | InChI=1S/C50H36N2SSi/c1-4-15-36(16-5-1)38-19-12-24-44(31-38)54(43-22-8-3-9-23-43,45-25-13-20-39(32-45)37-17-6-2-7-18-37)46-26-14-21-40(33-46)41-29-30-42-35-53-50-51-47-27-10-11-28-48(47)52(50)49(42)34-41/h1-34H,35H2 |
| InChIKey | ABQQKWMSEXVPAA-UHFFFAOYSA-N |
| XLogP | 10.01 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.01 |
| LogP ≤ 5 | 10.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|