C28H18N4S — CID 164764844
1-(4-phenylquinazolin-2-yl)-5H-benzimidazolo[1,2-a][3,1]benzothiazine (PubChem CID 164764844) has the molecular formula C28H18N4S and a molecular weight of 442.55 g/mol. Its IUPAC name is 1-(4-phenylquinazolin-2-yl)-5H-benzimidazolo[1,2-a][3,1]benzothiazine.
| Compound Name | 1-(4-phenylquinazolin-2-yl)-5H-benzimidazolo[1,2-a][3,1]benzothiazine |
|---|---|
| PubChem CID | 164764844 |
| Molecular Formula | C28H18N4S |
| Molecular Weight | 442.55 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | 1-(4-phenylquinazolin-2-yl)-5H-benzimidazolo[1,2-a][3,1]benzothiazine |
| SMILES | c1ccc(-c2nc(-c3cccc4c3-n3c(nc5ccccc53)SC4)nc3ccccc23)cc1 |
| InChI | InChI=1S/C28H18N4S/c1-2-9-18(10-3-1)25-20-12-4-5-14-22(20)29-27(31-25)21-13-8-11-19-17-33-28-30-23-15-6-7-16-24(23)32(28)26(19)21/h1-16H,17H2 |
| InChIKey | LYOSYAHFXRUPBF-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.55 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |