C13H11FN6O2S — CID 164779227
5-amino-N-(4-fluoro-3-isocyano-1H-indol-7-yl)-1-methylpyrazole-4-sulfonamide (PubChem CID 164779227) has the molecular formula C13H11FN6O2S and a molecular weight of 334.34 g/mol. Its IUPAC name is 5-amino-N-(4-fluoro-3-isocyano-1H-indol-7-yl)-1-methylpyrazole-4-sulfonamide.
| Compound Name | 5-amino-N-(4-fluoro-3-isocyano-1H-indol-7-yl)-1-methylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 164779227 |
| Molecular Formula | C13H11FN6O2S |
| Molecular Weight | 334.34 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | 5-amino-N-(4-fluoro-3-isocyano-1H-indol-7-yl)-1-methylpyrazole-4-sulfonamide |
| SMILES | [C-]#[N+]c1c[nH]c2c(NS(=O)(=O)c3cnn(C)c3N)ccc(F)c12 |
| InChI | InChI=1S/C13H11FN6O2S/c1-16-9-5-17-12-8(4-3-7(14)11(9)12)19-23(21,22)10-6-18-20(2)13(10)15/h3-6,17,19H,15H2,2H3 |
| InChIKey | QXVUIMBUTQUSHU-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 110.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.34 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|