C14H16Br2F2N4O2 — CID 164780098
tert-butyl (2R,4S)-4-(3,5-dibromo-4-isocyanopyrazol-1-yl)-2-(difluoromethyl)pyrrolidine-1-carboxylate (PubChem CID 164780098) has the molecular formula C14H16Br2F2N4O2 and a molecular weight of 470.11 g/mol. Its IUPAC name is tert-butyl (2R,4S)-4-(3,5-dibromo-4-isocyanopyrazol-1-yl)-2-(difluoromethyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R,4S)-4-(3,5-dibromo-4-isocyanopyrazol-1-yl)-2-(difluoromethyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 164780098 |
| Molecular Formula | C14H16Br2F2N4O2 |
| Molecular Weight | 470.11 g/mol |
| Exact Mass | 467.96 |
| IUPAC Name | tert-butyl (2R,4S)-4-(3,5-dibromo-4-isocyanopyrazol-1-yl)-2-(difluoromethyl)pyrrolidine-1-carboxylate |
| SMILES | [C-]#[N+]c1c(Br)nn([C@H]2C[C@H](C(F)F)N(C(=O)OC(C)(C)C)C2)c1Br |
| InChI | InChI=1S/C14H16Br2F2N4O2/c1-14(2,3)24-13(23)21-6-7(5-8(21)12(17)18)22-11(16)9(19-4)10(15)20-22/h7-8,12H,5-6H2,1-3H3/t7-,8+/m0/s1 |
| InChIKey | JPPXIXQVHKMQAC-JGVFFNPUSA-N |
| XLogP | 4.77 |
| TPSA | 51.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.11 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|