C14H17Br2FN4O2 — CID 164780236
tert-butyl (2S)-4-(3,5-dibromo-4-isocyanopyrazol-1-yl)-2-(fluoromethyl)pyrrolidine-1-carboxylate (PubChem CID 164780236) has the molecular formula C14H17Br2FN4O2 and a molecular weight of 452.12 g/mol. Its IUPAC name is tert-butyl (2S)-4-(3,5-dibromo-4-isocyanopyrazol-1-yl)-2-(fluoromethyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-4-(3,5-dibromo-4-isocyanopyrazol-1-yl)-2-(fluoromethyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 164780236 |
| Molecular Formula | C14H17Br2FN4O2 |
| Molecular Weight | 452.12 g/mol |
| Exact Mass | 449.97 |
| IUPAC Name | tert-butyl (2S)-4-(3,5-dibromo-4-isocyanopyrazol-1-yl)-2-(fluoromethyl)pyrrolidine-1-carboxylate |
| SMILES | [C-]#[N+]c1c(Br)nn(C2C[C@@H](CF)N(C(=O)OC(C)(C)C)C2)c1Br |
| InChI | InChI=1S/C14H17Br2FN4O2/c1-14(2,3)23-13(22)20-7-9(5-8(20)6-17)21-12(16)10(18-4)11(15)19-21/h8-9H,5-7H2,1-3H3/t8-,9?/m0/s1 |
| InChIKey | HSLQEZRIBIUDLG-IENPIDJESA-N |
| XLogP | 4.48 |
| TPSA | 51.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.12 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|