C33H31N7O2 — CID 164782922
5-benzyl-7-[4-[3-[(4-methoxyphenyl)methyl]-5-methyltriazol-4-yl]phenyl]-2,3,7,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5-trien-8-one (PubChem CID 164782922) has the molecular formula C33H31N7O2 and a molecular weight of 557.66 g/mol. Its IUPAC name is 5-benzyl-7-[4-[3-[(4-methoxyphenyl)methyl]-5-methyltriazol-4-yl]phenyl]-2,3,7,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5-trien-8-one.
| Compound Name | 5-benzyl-7-[4-[3-[(4-methoxyphenyl)methyl]-5-methyltriazol-4-yl]phenyl]-2,3,7,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5-trien-8-one |
|---|---|
| PubChem CID | 164782922 |
| Molecular Formula | C33H31N7O2 |
| Molecular Weight | 557.66 g/mol |
| Exact Mass | 557.25 |
| IUPAC Name | 5-benzyl-7-[4-[3-[(4-methoxyphenyl)methyl]-5-methyltriazol-4-yl]phenyl]-2,3,7,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5-trien-8-one |
| SMILES | COc1ccc(Cn2nnc(C)c2-c2ccc(-n3c(=O)c4c(n5ncc(Cc6ccccc6)c35)CNCC4)cc2)cc1 |
| InChI | InChI=1S/C33H31N7O2/c1-22-31(38(37-36-22)21-24-8-14-28(42-2)15-9-24)25-10-12-27(13-11-25)39-32-26(18-23-6-4-3-5-7-23)19-35-40(32)30-20-34-17-16-29(30)33(39)41/h3-15,19,34H,16-18,20-21H2,1-2H3 |
| InChIKey | ARWBYKGIEBUTKK-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 91.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.66 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |