About tert-butyl 1-(4-cyano-2-ethoxyphenyl)-6,7-dihydro-5H-pyrazolo[4,5-b]pyridine-4-carboxylate
tert-butyl 1-(4-cyano-2-ethoxyphenyl)-6,7-dihydro-5H-pyrazolo[4,5-b]pyridine-4-carboxylate (PubChem CID 164784443) has the molecular formula C20H24N4O3
and a molecular weight of 368.44 g/mol. Its IUPAC name is tert-butyl 1-(4-cyano-2-ethoxyphenyl)-6,7-dihydro-5H-pyrazolo[4,5-b]pyridine-4-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 1-(4-cyano-2-ethoxyphenyl)-6,7-dihydro-5H-pyrazolo[4,5-b]pyridine-4-carboxylate |
| PubChem CID | 164784443 |
| Molecular Formula | C20H24N4O3 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | tert-butyl 1-(4-cyano-2-ethoxyphenyl)-6,7-dihydro-5H-pyrazolo[4,5-b]pyridine-4-carboxylate |
| SMILES | CCOc1cc(C#N)ccc1-n1ncc2c1CCCN2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H24N4O3/c1-5-26-18-11-14(12-21)8-9-16(18)24-15-7-6-10-23(17(15)13-22-24)19(25)27-20(2,3)4/h8-9,11,13H,5-7,10H2,1-4H3 |
| InChIKey | FBNTURDKPASDKL-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 80.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze tert-butyl 1-(4-cyano-2-ethoxyphenyl)-6,7-dihydro-5H-pyrazolo[4,5-b]pyridine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 1-(4-cyano-2-ethoxyphenyl)-6,7-dihydro-5H-pyrazolo[4,5-b]pyridine-4-carboxylate?
The IUPAC name of tert-butyl 1-(4-cyano-2-ethoxyphenyl)-6,7-dihydro-5H-pyrazolo[4,5-b]pyridine-4-carboxylate (CID 164784443) is tert-butyl 1-(4-cyano-2-ethoxyphenyl)-6,7-dihydro-5H-pyrazolo[4,5-b]pyridine-4-carboxylate.
What is the SMILES notation for tert-butyl 1-(4-cyano-2-ethoxyphenyl)-6,7-dihydro-5H-pyrazolo[4,5-b]pyridine-4-carboxylate?
The canonical SMILES for tert-butyl 1-(4-cyano-2-ethoxyphenyl)-6,7-dihydro-5H-pyrazolo[4,5-b]pyridine-4-carboxylate is CCOc1cc(C#N)ccc1-n1ncc2c1CCCN2C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl 1-(4-cyano-2-ethoxyphenyl)-6,7-dihydro-5H-pyrazolo[4,5-b]pyridine-4-carboxylate?
The InChIKey is FBNTURDKPASDKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24N4O3/c1-5-26-18-11-14(12-21)8-9-16(18)24-15-7-6-10-23(17(15)13-22-24)19(25)27-20(2,3)4/h8-9,11,13H,5-7,10H2,1-4H3.
What are the key properties of tert-butyl 1-(4-cyano-2-ethoxyphenyl)-6,7-dihydro-5H-pyrazolo[4,5-b]pyridine-4-carboxylate?
tert-butyl 1-(4-cyano-2-ethoxyphenyl)-6,7-dihydro-5H-pyrazolo[4,5-b]pyridine-4-carboxylate has a molecular weight of 368.44 g/mol, XLogP of 3.83, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 1-(4-cyano-2-ethoxyphenyl)-6,7-dihydro-5H-pyrazolo[4,5-b]pyridine-4-carboxylate is sourced from PubChem (CID 164784443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).