C47H27N5O — CID 164784947
2-[6-[11-(3-isocyanophenyl)-21-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1,3,5,7,9,11,13,15,17,19-decaen-4-yl]-2-pyridinyl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 164784947) has the molecular formula C47H27N5O and a molecular weight of 677.77 g/mol. Its IUPAC name is 2-[6-[11-(3-isocyanophenyl)-21-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1,3,5,7,9,11,13,15,17,19-decaen-4-yl]-2-pyridinyl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[6-[11-(3-isocyanophenyl)-21-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1,3,5,7,9,11,13,15,17,19-decaen-4-yl]-2-pyridinyl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 164784947 |
| Molecular Formula | C47H27N5O |
| Molecular Weight | 677.77 g/mol |
| Exact Mass | 677.22 |
| IUPAC Name | 2-[6-[11-(3-isocyanophenyl)-21-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1,3,5,7,9,11,13,15,17,19-decaen-4-yl]-2-pyridinyl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | [C-]#[N+]c1cccc(-c2ccc3c4ccc(-c5cccc(-c6nc(-c7ccccc7)nc(-c7ccccc7)n6)n5)cc4c4oc5ccccc5c4c3c2)c1 |
| InChI | InChI=1S/C47H27N5O/c1-48-34-17-10-16-31(26-34)32-22-24-35-36-25-23-33(28-39(36)44-43(38(35)27-32)37-18-8-9-21-42(37)53-44)40-19-11-20-41(49-40)47-51-45(29-12-4-2-5-13-29)50-46(52-47)30-14-6-3-7-15-30/h2-28H |
| InChIKey | XZJMMAHTLYAYBG-UHFFFAOYSA-N |
| XLogP | 12.36 |
| TPSA | 69.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.77 |
| LogP ≤ 5 | 12.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|