C24H28BrClN6O7 — CID 164786194
tert-butyl N-[3-[[(2R)-1-[(3-bromo-4-methoxy-5-nitrophenyl)methoxy]propan-2-yl]carbamoyl]-5-chloropyrazolo[1,5-a]pyrimidin-7-yl]-N-methylcarbamate (PubChem CID 164786194) has the molecular formula C24H28BrClN6O7 and a molecular weight of 627.88 g/mol. Its IUPAC name is tert-butyl N-[3-[[(2R)-1-[(3-bromo-4-methoxy-5-nitrophenyl)methoxy]propan-2-yl]carbamoyl]-5-chloropyrazolo[1,5-a]pyrimidin-7-yl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[3-[[(2R)-1-[(3-bromo-4-methoxy-5-nitrophenyl)methoxy]propan-2-yl]carbamoyl]-5-chloropyrazolo[1,5-a]pyrimidin-7-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 164786194 |
| Molecular Formula | C24H28BrClN6O7 |
| Molecular Weight | 627.88 g/mol |
| Exact Mass | 626.09 |
| IUPAC Name | tert-butyl N-[3-[[(2R)-1-[(3-bromo-4-methoxy-5-nitrophenyl)methoxy]propan-2-yl]carbamoyl]-5-chloropyrazolo[1,5-a]pyrimidin-7-yl]-N-methylcarbamate |
| SMILES | COc1c(Br)cc(COC[C@@H](C)NC(=O)c2cnn3c(N(C)C(=O)OC(C)(C)C)cc(Cl)nc23)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H28BrClN6O7/c1-13(11-38-12-14-7-16(25)20(37-6)17(8-14)32(35)36)28-22(33)15-10-27-31-19(9-18(26)29-21(15)31)30(5)23(34)39-24(2,3)4/h7-10,13H,11-12H2,1-6H3,(H,28,33)/t13-/m1/s1 |
| InChIKey | LBBMAYWUSPEPNQ-CYBMUJFWSA-N |
| XLogP | 4.77 |
| TPSA | 150.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.88 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|